C30H38N8O2 — CID 162068266
4-(3-methylimidazol-4-yl)-1-(4-nitrophenyl)piperidine;4-[4-(3-methylimidazol-4-yl)piperidin-1-yl]aniline (PubChem CID 162068266) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is 4-(3-methylimidazol-4-yl)-1-(4-nitrophenyl)piperidine;4-[4-(3-methylimidazol-4-yl)piperidin-1-yl]aniline.
| Compound Name | 4-(3-methylimidazol-4-yl)-1-(4-nitrophenyl)piperidine;4-[4-(3-methylimidazol-4-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 162068266 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 4-(3-methylimidazol-4-yl)-1-(4-nitrophenyl)piperidine;4-[4-(3-methylimidazol-4-yl)piperidin-1-yl]aniline |
| SMILES | Cn1cncc1C1CCN(c2ccc(N)cc2)CC1.Cn1cncc1C1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C15H18N4O2.C15H20N4/c1-17-11-16-10-15(17)12-6-8-18(9-7-12)13-2-4-14(5-3-13)19(20)21;1-18-11-17-10-15(18)12-6-8-19(9-7-12)14-4-2-13(16)3-5-14/h2-5,10-12H,6-9H2,1H3;2-5,10-12H,6-9,16H2,1H3 |
| InChIKey | ZASURYZMQJEMAD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|