C36H58N8O4 — CID 158085053
N-[(3R)-1-(4-aminophenyl)pyrrolidin-3-yl]-N-[2-(diethylamino)ethyl]acetamide;N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide (PubChem CID 158085053) has the molecular formula C36H58N8O4 and a molecular weight of 666.91 g/mol. Its IUPAC name is N-[(3R)-1-(4-aminophenyl)pyrrolidin-3-yl]-N-[2-(diethylamino)ethyl]acetamide;N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[(3R)-1-(4-aminophenyl)pyrrolidin-3-yl]-N-[2-(diethylamino)ethyl]acetamide;N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 158085053 |
| Molecular Formula | C36H58N8O4 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.46 |
| IUPAC Name | N-[(3R)-1-(4-aminophenyl)pyrrolidin-3-yl]-N-[2-(diethylamino)ethyl]acetamide;N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide |
| SMILES | CCN(CC)CCN(C(C)=O)[C@@H]1CCN(c2ccc(N)cc2)C1.CCN(CC)CCN(C(C)=O)[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H28N4O3.C18H30N4O/c1-4-19(5-2)12-13-21(15(3)23)18-10-11-20(14-18)16-6-8-17(9-7-16)22(24)25;1-4-20(5-2)12-13-22(15(3)23)18-10-11-21(14-18)17-8-6-16(19)7-9-17/h6-9,18H,4-5,10-14H2,1-3H3;6-9,18H,4-5,10-14,19H2,1-3H3/t2*18-/m11/s1 |
| InChIKey | FNKKXOUMBDELLS-BJRQBULFSA-N |
| XLogP | 4.40 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|