C30H43N7O6 — CID 160663916
N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide;N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide (PubChem CID 160663916) has the molecular formula C30H43N7O6 and a molecular weight of 597.72 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide;N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide;N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 160663916 |
| Molecular Formula | C30H43N7O6 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide;N-[(3R)-1-(4-nitrophenyl)pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2)C1.CCN(CC)CCN(C(C)=O)[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H28N4O3.C12H15N3O3/c1-4-19(5-2)12-13-21(15(3)23)18-10-11-20(14-18)16-6-8-17(9-7-16)22(24)25;1-9(16)13-10-6-7-14(8-10)11-2-4-12(5-3-11)15(17)18/h6-9,18H,4-5,10-14H2,1-3H3;2-5,10H,6-8H2,1H3,(H,13,16)/t18-;10-/m11/s1 |
| InChIKey | RMARGTYHPUOADA-YEXLWCPGSA-N |
| XLogP | 3.67 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|