C17H29N3O — CID 145237121
1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;prop-1-ene (PubChem CID 145237121) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;prop-1-ene.
| Compound Name | 1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;prop-1-ene |
|---|---|
| PubChem CID | 145237121 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;prop-1-ene |
| SMILES | C=CC.COc1cc(N2CCC(N(C)C)CC2)ccc1N |
| InChI | InChI=1S/C14H23N3O.C3H6/c1-16(2)11-6-8-17(9-7-11)12-4-5-13(15)14(10-12)18-3;1-3-2/h4-5,10-11H,6-9,15H2,1-3H3;3H,1H2,2H3 |
| InChIKey | QOIOTMMWOLICRF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|