C14H21N3O2 — CID 167154013
1-(4-methoxy-3-nitrosophenyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 167154013) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-(4-methoxy-3-nitrosophenyl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(4-methoxy-3-nitrosophenyl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 167154013 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-(4-methoxy-3-nitrosophenyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | COc1ccc(N2CCC(N(C)C)CC2)cc1N=O |
| InChI | InChI=1S/C14H21N3O2/c1-16(2)11-6-8-17(9-7-11)12-4-5-14(19-3)13(10-12)15-18/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | QTOBQXAFBDOKRX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|