C18H30N5O+ — CID 123281053
[N-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyphenyl]-N'-methylcarbamimidoyl]-methyl-methylideneazanium (PubChem CID 123281053) has the molecular formula C18H30N5O+ and a molecular weight of 332.47 g/mol. Its IUPAC name is [N-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyphenyl]-N'-methylcarbamimidoyl]-methyl-methylideneazanium.
| Compound Name | [N-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyphenyl]-N'-methylcarbamimidoyl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123281053 |
| Molecular Formula | C18H30N5O+ |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [N-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyphenyl]-N'-methylcarbamimidoyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)/C(=N\C)Nc1ccc(N2CCC(N(C)C)CC2)cc1OC |
| InChI | InChI=1S/C18H30N5O/c1-19-18(22(4)5)20-16-8-7-15(13-17(16)24-6)23-11-9-14(10-12-23)21(2)3/h7-8,13-14H,4,9-12H2,1-3,5-6H3,(H,19,20)/q+1 |
| InChIKey | HCPXIJZDCCTRGB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|