C10H17N5O3 — CID 125499086
(6R)-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)-1,4-diazepan-6-ol (PubChem CID 125499086) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is (6R)-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)-1,4-diazepan-6-ol.
| Compound Name | (6R)-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 125499086 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (6R)-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)-1,4-diazepan-6-ol |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCNC[C@@](C)(O)C1 |
| InChI | InChI=1S/C10H17N5O3/c1-10(16)6-11-3-4-14(7-10)9-8(15(17)18)5-12-13(9)2/h5,11,16H,3-4,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | QVYGKOOVEILTBI-SNVBAGLBSA-N |
| XLogP | -0.51 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|