C11H15F2N7O3 — CID 89456706
5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-3-ol (PubChem CID 89456706) has the molecular formula C11H15F2N7O3 and a molecular weight of 331.28 g/mol. Its IUPAC name is 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-3-ol.
| Compound Name | 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-3-ol |
|---|---|
| PubChem CID | 89456706 |
| Molecular Formula | C11H15F2N7O3 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-3-ol |
| SMILES | [N-]=[N+]=NC1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CC(O)C1 |
| InChI | InChI=1S/C11H15F2N7O3/c12-10(13)6-19-11(9(4-15-19)20(22)23)18-2-1-7(16-17-14)3-8(21)5-18/h4,7-8,10,21H,1-3,5-6H2 |
| InChIKey | ZELLHFMBEYYGHA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|