C14H21N5O5 — CID 86680013
tert-butyl 4-(1-methyl-4-nitropyrazol-5-yl)-5-oxo-1,4-diazepane-1-carboxylate (PubChem CID 86680013) has the molecular formula C14H21N5O5 and a molecular weight of 339.35 g/mol. Its IUPAC name is tert-butyl 4-(1-methyl-4-nitropyrazol-5-yl)-5-oxo-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(1-methyl-4-nitropyrazol-5-yl)-5-oxo-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 86680013 |
| Molecular Formula | C14H21N5O5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl 4-(1-methyl-4-nitropyrazol-5-yl)-5-oxo-1,4-diazepane-1-carboxylate |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C14H21N5O5/c1-14(2,3)24-13(21)17-6-5-11(20)18(8-7-17)12-10(19(22)23)9-15-16(12)4/h9H,5-8H2,1-4H3 |
| InChIKey | FVCGNBPOESUEFT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|