C13H18N4O5 — CID 118288827
tert-butyl 3-(4-nitropyrazol-1-yl)-4-oxopiperidine-1-carboxylate (PubChem CID 118288827) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is tert-butyl 3-(4-nitropyrazol-1-yl)-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-nitropyrazol-1-yl)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118288827 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | tert-butyl 3-(4-nitropyrazol-1-yl)-4-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(n2cc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C13H18N4O5/c1-13(2,3)22-12(19)15-5-4-11(18)10(8-15)16-7-9(6-14-16)17(20)21/h6-7,10H,4-5,8H2,1-3H3 |
| InChIKey | NXMTVLPMEXUIPC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|