C13H17N5O4 — CID 163210492
tert-butyl 3-(cyanomethyl)-3-(4-nitropyrazol-1-yl)azetidine-1-carboxylate (PubChem CID 163210492) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is tert-butyl 3-(cyanomethyl)-3-(4-nitropyrazol-1-yl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(cyanomethyl)-3-(4-nitropyrazol-1-yl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163210492 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | tert-butyl 3-(cyanomethyl)-3-(4-nitropyrazol-1-yl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CC#N)(n2cc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C13H17N5O4/c1-12(2,3)22-11(19)16-8-13(9-16,4-5-14)17-7-10(6-15-17)18(20)21/h6-7H,4,8-9H2,1-3H3 |
| InChIKey | LGWPMCRHEKATQM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 114.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|