C15H23N5O2 — CID 123774633
tert-butyl 3-(cyanomethyl)-3-[4-(dimethylamino)pyrazol-1-yl]azetidine-1-carboxylate (PubChem CID 123774633) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is tert-butyl 3-(cyanomethyl)-3-[4-(dimethylamino)pyrazol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(cyanomethyl)-3-[4-(dimethylamino)pyrazol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 123774633 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | tert-butyl 3-(cyanomethyl)-3-[4-(dimethylamino)pyrazol-1-yl]azetidine-1-carboxylate |
| SMILES | CN(C)c1cnn(C2(CC#N)CN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C15H23N5O2/c1-14(2,3)22-13(21)19-10-15(11-19,6-7-16)20-9-12(8-17-20)18(4)5/h8-9H,6,10-11H2,1-5H3 |
| InChIKey | VTFNHLHHUQHAQU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |