C21H25Cl2N7O3 — CID 89473490
tert-butyl 4-[4-carbamoyl-3-[(2,6-dichloro-4-pyridinyl)amino]pyrazol-1-yl]-4-(cyanomethyl)piperidine-1-carboxylate (PubChem CID 89473490) has the molecular formula C21H25Cl2N7O3 and a molecular weight of 494.38 g/mol. Its IUPAC name is tert-butyl 4-[4-carbamoyl-3-[(2,6-dichloro-4-pyridinyl)amino]pyrazol-1-yl]-4-(cyanomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-carbamoyl-3-[(2,6-dichloro-4-pyridinyl)amino]pyrazol-1-yl]-4-(cyanomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89473490 |
| Molecular Formula | C21H25Cl2N7O3 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | tert-butyl 4-[4-carbamoyl-3-[(2,6-dichloro-4-pyridinyl)amino]pyrazol-1-yl]-4-(cyanomethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC#N)(n2cc(C(N)=O)c(Nc3cc(Cl)nc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C21H25Cl2N7O3/c1-20(2,3)33-19(32)29-8-5-21(4-7-24,6-9-29)30-12-14(17(25)31)18(28-30)26-13-10-15(22)27-16(23)11-13/h10-12H,4-6,8-9H2,1-3H3,(H2,25,31)(H,26,27,28) |
| InChIKey | YGTIBEJMKHOJJP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|