C20H24N6O3 — CID 89462244
3-anilino-1-[4-(cyanomethyl)-1-(2-methoxyacetyl)piperidin-4-yl]pyrazole-4-carboxamide (PubChem CID 89462244) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-anilino-1-[4-(cyanomethyl)-1-(2-methoxyacetyl)piperidin-4-yl]pyrazole-4-carboxamide.
| Compound Name | 3-anilino-1-[4-(cyanomethyl)-1-(2-methoxyacetyl)piperidin-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89462244 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-anilino-1-[4-(cyanomethyl)-1-(2-methoxyacetyl)piperidin-4-yl]pyrazole-4-carboxamide |
| SMILES | COCC(=O)N1CCC(CC#N)(n2cc(C(N)=O)c(Nc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H24N6O3/c1-29-14-17(27)25-11-8-20(7-10-21,9-12-25)26-13-16(18(22)28)19(24-26)23-15-5-3-2-4-6-15/h2-6,13H,7-9,11-12,14H2,1H3,(H2,22,28)(H,23,24) |
| InChIKey | JPKPCRNPOCBTKL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |