C31H34N6O2 — CID 134407769
3-anilino-1-[4-(cyanomethyl)-1-[(Z,3E)-3-ethylidene-2-phenylhex-4-enoyl]piperidin-4-yl]pyrazole-4-carboxamide (PubChem CID 134407769) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 3-anilino-1-[4-(cyanomethyl)-1-[(Z,3E)-3-ethylidene-2-phenylhex-4-enoyl]piperidin-4-yl]pyrazole-4-carboxamide.
| Compound Name | 3-anilino-1-[4-(cyanomethyl)-1-[(Z,3E)-3-ethylidene-2-phenylhex-4-enoyl]piperidin-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134407769 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 3-anilino-1-[4-(cyanomethyl)-1-[(Z,3E)-3-ethylidene-2-phenylhex-4-enoyl]piperidin-4-yl]pyrazole-4-carboxamide |
| SMILES | C/C=C\C(=C/C)C(C(=O)N1CCC(CC#N)(n2cc(C(N)=O)c(Nc3ccccc3)n2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H34N6O2/c1-3-11-23(4-2)27(24-12-7-5-8-13-24)30(39)36-20-17-31(16-19-32,18-21-36)37-22-26(28(33)38)29(35-37)34-25-14-9-6-10-15-25/h3-15,22,27H,16-18,20-21H2,1-2H3,(H2,33,38)(H,34,35)/b11-3-,23-4+ |
| InChIKey | HBQPZHFOTQZJNR-UHGULHRZSA-N |
| XLogP | 5.26 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|