C22H28FN7O2 — CID 89473551
1-[4-(cyanomethyl)-1-(3,3-dimethylbutanoyl)piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 89473551) has the molecular formula C22H28FN7O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)-1-(3,3-dimethylbutanoyl)piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[4-(cyanomethyl)-1-(3,3-dimethylbutanoyl)piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89473551 |
| Molecular Formula | C22H28FN7O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[4-(cyanomethyl)-1-(3,3-dimethylbutanoyl)piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1CCC(CC#N)(n2cc(C(N)=O)c(Nc3ccnc(F)c3)n2)CC1 |
| InChI | InChI=1S/C22H28FN7O2/c1-21(2,3)13-18(31)29-10-6-22(5-8-24,7-11-29)30-14-16(19(25)32)20(28-30)27-15-4-9-26-17(23)12-15/h4,9,12,14H,5-7,10-11,13H2,1-3H3,(H2,25,32)(H,26,27,28) |
| InChIKey | BWHNEOADZZKZMN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|