C25H26FN7O — CID 90331900
1-[1-(cyanomethyl)-4-(2,3-dihydroindol-1-yl)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 90331900) has the molecular formula C25H26FN7O and a molecular weight of 459.53 g/mol. Its IUPAC name is 1-[1-(cyanomethyl)-4-(2,3-dihydroindol-1-yl)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[1-(cyanomethyl)-4-(2,3-dihydroindol-1-yl)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90331900 |
| Molecular Formula | C25H26FN7O |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-[1-(cyanomethyl)-4-(2,3-dihydroindol-1-yl)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | N#CCC1(n2cc(C(N)=O)c(Nc3ccnc(F)c3)n2)CCC(N2CCc3ccccc32)CC1 |
| InChI | InChI=1S/C25H26FN7O/c26-22-15-18(7-13-29-22)30-24-20(23(28)34)16-33(31-24)25(11-12-27)9-5-19(6-10-25)32-14-8-17-3-1-2-4-21(17)32/h1-4,7,13,15-16,19H,5-6,8-11,14H2,(H2,28,34)(H,29,30,31) |
| InChIKey | NCBZMMXJYFCMMC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|