C23H27FN6O2 — CID 89473482
3-[(2-fluoro-4-pyridinyl)amino]-1-[4-[(2-hydroxyphenyl)methylamino]-1-methylcyclohexyl]pyrazole-4-carboxamide (PubChem CID 89473482) has the molecular formula C23H27FN6O2 and a molecular weight of 438.51 g/mol. Its IUPAC name is 3-[(2-fluoro-4-pyridinyl)amino]-1-[4-[(2-hydroxyphenyl)methylamino]-1-methylcyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-[(2-fluoro-4-pyridinyl)amino]-1-[4-[(2-hydroxyphenyl)methylamino]-1-methylcyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89473482 |
| Molecular Formula | C23H27FN6O2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3-[(2-fluoro-4-pyridinyl)amino]-1-[4-[(2-hydroxyphenyl)methylamino]-1-methylcyclohexyl]pyrazole-4-carboxamide |
| SMILES | CC1(n2cc(C(N)=O)c(Nc3ccnc(F)c3)n2)CCC(NCc2ccccc2O)CC1 |
| InChI | InChI=1S/C23H27FN6O2/c1-23(9-6-16(7-10-23)27-13-15-4-2-3-5-19(15)31)30-14-18(21(25)32)22(29-30)28-17-8-11-26-20(24)12-17/h2-5,8,11-12,14,16,27,31H,6-7,9-10,13H2,1H3,(H2,25,32)(H,26,28,29) |
| InChIKey | AELPISVTYUWNCD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|