C23H24FN7O — CID 89473587
1-[1-[(3-cyanophenyl)methyl]-4-methylpiperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 89473587) has the molecular formula C23H24FN7O and a molecular weight of 433.49 g/mol. Its IUPAC name is 1-[1-[(3-cyanophenyl)methyl]-4-methylpiperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[1-[(3-cyanophenyl)methyl]-4-methylpiperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89473587 |
| Molecular Formula | C23H24FN7O |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[1-[(3-cyanophenyl)methyl]-4-methylpiperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | CC1(n2cc(C(N)=O)c(Nc3ccnc(F)c3)n2)CCN(Cc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C23H24FN7O/c1-23(6-9-30(10-7-23)14-17-4-2-3-16(11-17)13-25)31-15-19(21(26)32)22(29-31)28-18-5-8-27-20(24)12-18/h2-5,8,11-12,15H,6-7,9-10,14H2,1H3,(H2,26,32)(H,27,28,29) |
| InChIKey | GGEUINZVFKXGJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|