C15H15FN6O — CID 71538223
1-(2-cyano-1-cyclopropylethyl)-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 71538223) has the molecular formula C15H15FN6O and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-(2-cyano-1-cyclopropylethyl)-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyano-1-cyclopropylethyl)-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71538223 |
| Molecular Formula | C15H15FN6O |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(2-cyano-1-cyclopropylethyl)-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | N#CCC(C1CC1)n1cc(C(N)=O)c(Nc2ccnc(F)c2)n1 |
| InChI | InChI=1S/C15H15FN6O/c16-13-7-10(4-6-19-13)20-15-11(14(18)23)8-22(21-15)12(3-5-17)9-1-2-9/h4,6-9,12H,1-3H2,(H2,18,23)(H,19,20,21) |
| InChIKey | RBHGKYJXGOGINC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|