C18H18N6O2 — CID 71534830
3-(3,7b-dihydrooxazireno[3,2-a]isoindol-5-ylamino)-1-(2-cyano-1-cyclopropylethyl)pyrazole-4-carboxamide (PubChem CID 71534830) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-(3,7b-dihydrooxazireno[3,2-a]isoindol-5-ylamino)-1-(2-cyano-1-cyclopropylethyl)pyrazole-4-carboxamide.
| Compound Name | 3-(3,7b-dihydrooxazireno[3,2-a]isoindol-5-ylamino)-1-(2-cyano-1-cyclopropylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71534830 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-(3,7b-dihydrooxazireno[3,2-a]isoindol-5-ylamino)-1-(2-cyano-1-cyclopropylethyl)pyrazole-4-carboxamide |
| SMILES | N#CCC(C1CC1)n1cc(C(N)=O)c(Nc2ccc3c(c2)CN2OC32)n1 |
| InChI | InChI=1S/C18H18N6O2/c19-6-5-15(10-1-2-10)23-9-14(16(20)25)17(22-23)21-12-3-4-13-11(7-12)8-24-18(13)26-24/h3-4,7,9-10,15,18H,1-2,5,8H2,(H2,20,25)(H,21,22) |
| InChIKey | MGBUOLSZAOSDSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|