C18H22FN6O+ — CID 140650157
1-[(1S)-2-cyano-1-piperidin-1-ium-4-ylethyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 140650157) has the molecular formula C18H22FN6O+ and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[(1S)-2-cyano-1-piperidin-1-ium-4-ylethyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[(1S)-2-cyano-1-piperidin-1-ium-4-ylethyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 140650157 |
| Molecular Formula | C18H22FN6O+ |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-[(1S)-2-cyano-1-piperidin-1-ium-4-ylethyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | N#CC[C@@H](C1CC[NH2+]CC1)n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H21FN6O/c19-13-1-3-14(4-2-13)23-18-15(17(21)26)11-25(24-18)16(5-8-20)12-6-9-22-10-7-12/h1-4,11-12,16,22H,5-7,9-10H2,(H2,21,26)(H,23,24)/p+1/t16-/m0/s1 |
| InChIKey | OHLYMWHAWXVNOQ-INIZCTEOSA-O |
| XLogP | 1.29 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |