C14H15FN6O3S — CID 90343770
1-[(3R,4R)-4-cyano-1,1-dihydroxythiolan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 90343770) has the molecular formula C14H15FN6O3S and a molecular weight of 366.38 g/mol. Its IUPAC name is 1-[(3R,4R)-4-cyano-1,1-dihydroxythiolan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3R,4R)-4-cyano-1,1-dihydroxythiolan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90343770 |
| Molecular Formula | C14H15FN6O3S |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[(3R,4R)-4-cyano-1,1-dihydroxythiolan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | N#C[C@@H]1CS(O)(O)C[C@@H]1n1cc(C(N)=O)c(Nc2ccnc(F)c2)n1 |
| InChI | InChI=1S/C14H15FN6O3S/c15-12-3-9(1-2-18-12)19-14-10(13(17)22)5-21(20-14)11-7-25(23,24)6-8(11)4-16/h1-3,5,8,11,23-24H,6-7H2,(H2,17,22)(H,18,19,20)/t8-,11+/m1/s1 |
| InChIKey | ORGYUEHPXBCURK-KCJUWKMLSA-N |
| XLogP | 1.70 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|