C18H22FN7O — CID 90367291
1-[(1S,2S,4R)-2-cyano-4-(dimethylamino)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 90367291) has the molecular formula C18H22FN7O and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-[(1S,2S,4R)-2-cyano-4-(dimethylamino)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1S,2S,4R)-2-cyano-4-(dimethylamino)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90367291 |
| Molecular Formula | C18H22FN7O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-[(1S,2S,4R)-2-cyano-4-(dimethylamino)cyclohexyl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | CN(C)[C@@H]1CC[C@H](n2cc(C(N)=O)c(Nc3ccnc(F)c3)n2)[C@@H](C#N)C1 |
| InChI | InChI=1S/C18H22FN7O/c1-25(2)13-3-4-15(11(7-13)9-20)26-10-14(17(21)27)18(24-26)23-12-5-6-22-16(19)8-12/h5-6,8,10-11,13,15H,3-4,7H2,1-2H3,(H2,21,27)(H,22,23,24)/t11-,13-,15+/m1/s1 |
| InChIKey | DKVUTGLTXOUOQO-KYOSRNDESA-N |
| XLogP | 2.05 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|