C16H17FN6O2 — CID 90350610
1-[(2R,3S)-4-cyano-2-methyloxan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 90350610) has the molecular formula C16H17FN6O2 and a molecular weight of 344.35 g/mol. Its IUPAC name is 1-[(2R,3S)-4-cyano-2-methyloxan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(2R,3S)-4-cyano-2-methyloxan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90350610 |
| Molecular Formula | C16H17FN6O2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-[(2R,3S)-4-cyano-2-methyloxan-3-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | C[C@H]1OCCC(C#N)[C@@H]1n1cc(C(N)=O)c(Nc2ccnc(F)c2)n1 |
| InChI | InChI=1S/C16H17FN6O2/c1-9-14(10(7-18)3-5-25-9)23-8-12(15(19)24)16(22-23)21-11-2-4-20-13(17)6-11/h2,4,6,8-10,14H,3,5H2,1H3,(H2,19,24)(H,20,21,22)/t9-,10?,14-/m1/s1 |
| InChIKey | KJVVQQFIXKPBHR-KWBIFUEGSA-N |
| XLogP | 1.75 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|