C16H17N5O2 — CID 89471136
3-anilino-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazole-4-carboxamide (PubChem CID 89471136) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-anilino-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-anilino-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89471136 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-anilino-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazole-4-carboxamide |
| SMILES | N#C[C@H]1CCOC[C@@H]1n1cc(C(N)=O)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H17N5O2/c17-8-11-6-7-23-10-14(11)21-9-13(15(18)22)16(20-21)19-12-4-2-1-3-5-12/h1-5,9,11,14H,6-7,10H2,(H2,18,22)(H,19,20)/t11-,14+/m1/s1 |
| InChIKey | OQNGITUNHHCSOA-RISCZKNCSA-N |
| XLogP | 1.83 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |