C11H14N4O2 — CID 154933810
1-(4-cyanooxan-3-yl)-3-methylpyrazole-4-carboxamide (PubChem CID 154933810) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-(4-cyanooxan-3-yl)-3-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-cyanooxan-3-yl)-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154933810 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-(4-cyanooxan-3-yl)-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C2COCCC2C#N)cc1C(N)=O |
| InChI | InChI=1S/C11H14N4O2/c1-7-9(11(13)16)5-15(14-7)10-6-17-3-2-8(10)4-12/h5,8,10H,2-3,6H2,1H3,(H2,13,16) |
| InChIKey | REKPCPZTABLHQV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |