C24H30BN5O6 — CID 174013027
methyl 4-[[4-carbamoyl-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 174013027) has the molecular formula C24H30BN5O6 and a molecular weight of 495.35 g/mol. Its IUPAC name is methyl 4-[[4-carbamoyl-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 4-[[4-carbamoyl-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 174013027 |
| Molecular Formula | C24H30BN5O6 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | methyl 4-[[4-carbamoyl-1-[(3R,4S)-4-cyanooxan-3-yl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(Nc2nn([C@H]3COCC[C@@H]3C#N)cc2C(N)=O)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H30BN5O6/c1-23(2)24(3,4)36-25(35-23)18-10-15(6-7-16(18)22(32)33-5)28-21-17(20(27)31)12-30(29-21)19-13-34-9-8-14(19)11-26/h6-7,10,12,14,19H,8-9,13H2,1-5H3,(H2,27,31)(H,28,29)/t14-,19+/m1/s1 |
| InChIKey | VUKKNAMOEVTTDM-KUHUBIRLSA-N |
| XLogP | 1.91 |
| TPSA | 150.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|