C18H17B2N5O4 — CID 164542945
CID 164542945 (PubChem CID 164542945) has the molecular formula C18H17B2N5O4 and a molecular weight of 388.99 g/mol.
| Compound Name | CID 164542945 |
|---|---|
| PubChem CID | 164542945 |
| Molecular Formula | C18H17B2N5O4 |
| Molecular Weight | 388.99 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | — |
| SMILES | [B]C1=CB(O)Oc2ccc(Nc3nn(C4COCCC4C#N)cc3C(N)=O)cc21 |
| InChI | InChI=1S/C18H17B2N5O4/c19-14-6-20(27)29-16-2-1-11(5-12(14)16)23-18-13(17(22)26)8-25(24-18)15-9-28-4-3-10(15)7-21/h1-2,5-6,8,10,15,27H,3-4,9H2,(H2,22,26)(H,23,24) |
| InChIKey | MGMIJZVCGNQAEK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.99 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|