C18H18BN5O3 — CID 174013096
1-[(1S)-2-cyanocyclopentyl]-3-[(2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 174013096) has the molecular formula C18H18BN5O3 and a molecular weight of 363.19 g/mol. Its IUPAC name is 1-[(1S)-2-cyanocyclopentyl]-3-[(2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1S)-2-cyanocyclopentyl]-3-[(2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013096 |
| Molecular Formula | C18H18BN5O3 |
| Molecular Weight | 363.19 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-[(1S)-2-cyanocyclopentyl]-3-[(2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | N#CC1CCC[C@@H]1n1cc(C(N)=O)c(Nc2ccc3c(c2)C=CB(O)O3)n1 |
| InChI | InChI=1S/C18H18BN5O3/c20-9-12-2-1-3-15(12)24-10-14(17(21)25)18(23-24)22-13-4-5-16-11(8-13)6-7-19(26)27-16/h4-8,10,12,15,26H,1-3H2,(H2,21,25)(H,22,23)/t12?,15-/m0/s1 |
| InChIKey | BWQPNCWENITYQI-CVRLYYSRSA-N |
| XLogP | 2.02 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|