C18H18BN5O4 — CID 164800646
3-[(2-hydroxy-1,2-benzoxaborinin-7-yl)amino]-1-[(4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide (PubChem CID 164800646) has the molecular formula C18H18BN5O4 and a molecular weight of 379.19 g/mol. Its IUPAC name is 3-[(2-hydroxy-1,2-benzoxaborinin-7-yl)amino]-1-[(4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[(2-hydroxy-1,2-benzoxaborinin-7-yl)amino]-1-[(4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164800646 |
| Molecular Formula | C18H18BN5O4 |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-[(2-hydroxy-1,2-benzoxaborinin-7-yl)amino]-1-[(4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide |
| SMILES | [C-]#[N+][C@H]1CCOCC1n1cc(C(N)=O)c(Nc2ccc3c(c2)OB(O)C=C3)n1 |
| InChI | InChI=1S/C18H18BN5O4/c1-21-14-5-7-27-10-15(14)24-9-13(17(20)25)18(23-24)22-12-3-2-11-4-6-19(26)28-16(11)8-12/h2-4,6,8-9,14-15,26H,5,7,10H2,(H2,20,25)(H,22,23)/t14-,15?/m0/s1 |
| InChIKey | NFVAUJJNIAMOPU-MLCCFXAWSA-N |
| XLogP | 1.40 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|