C19H23BN4O4 — CID 174013739
3-[(2-hydroxy-7-methyl-1,2-benzoxaborinin-6-yl)amino]-1-[(4S)-4-methyloxan-3-yl]pyrazole-4-carboxamide (PubChem CID 174013739) has the molecular formula C19H23BN4O4 and a molecular weight of 382.23 g/mol. Its IUPAC name is 3-[(2-hydroxy-7-methyl-1,2-benzoxaborinin-6-yl)amino]-1-[(4S)-4-methyloxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[(2-hydroxy-7-methyl-1,2-benzoxaborinin-6-yl)amino]-1-[(4S)-4-methyloxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013739 |
| Molecular Formula | C19H23BN4O4 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[(2-hydroxy-7-methyl-1,2-benzoxaborinin-6-yl)amino]-1-[(4S)-4-methyloxan-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1cc2c(cc1Nc1nn(C3COCC[C@@H]3C)cc1C(N)=O)C=CB(O)O2 |
| InChI | InChI=1S/C19H23BN4O4/c1-11-4-6-27-10-16(11)24-9-14(18(21)25)19(23-24)22-15-8-13-3-5-20(26)28-17(13)7-12(15)2/h3,5,7-9,11,16,26H,4,6,10H2,1-2H3,(H2,21,25)(H,22,23)/t11-,16?/m0/s1 |
| InChIKey | BYLDOKCIVQTQNK-CHPOKUKFSA-N |
| XLogP | 2.06 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|