C21H24BN5O4 — CID 164800643
1-[(4S)-4-cyanooxan-3-yl]-3-[(2-hydroxy-3,4,8-trimethyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 164800643) has the molecular formula C21H24BN5O4 and a molecular weight of 421.27 g/mol. Its IUPAC name is 1-[(4S)-4-cyanooxan-3-yl]-3-[(2-hydroxy-3,4,8-trimethyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(4S)-4-cyanooxan-3-yl]-3-[(2-hydroxy-3,4,8-trimethyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164800643 |
| Molecular Formula | C21H24BN5O4 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[(4S)-4-cyanooxan-3-yl]-3-[(2-hydroxy-3,4,8-trimethyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | CC1=C(C)c2cc(Nc3nn(C4COCC[C@@H]4C#N)cc3C(N)=O)cc(C)c2OB1O |
| InChI | InChI=1S/C21H24BN5O4/c1-11-6-15(7-16-12(2)13(3)22(29)31-19(11)16)25-21-17(20(24)28)9-27(26-21)18-10-30-5-4-14(18)8-23/h6-7,9,14,18,29H,4-5,10H2,1-3H3,(H2,24,28)(H,25,26)/t14-,18?/m1/s1 |
| InChIKey | YCUGUSSAJLYADB-IKJXHCRLSA-N |
| XLogP | 2.34 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|