C22H26BN5O4 — CID 174013056
1-(4-cyanooxan-3-yl)-3-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 174013056) has the molecular formula C22H26BN5O4 and a molecular weight of 435.29 g/mol. Its IUPAC name is 1-(4-cyanooxan-3-yl)-3-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-(4-cyanooxan-3-yl)-3-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013056 |
| Molecular Formula | C22H26BN5O4 |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-(4-cyanooxan-3-yl)-3-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | CCC1=C(CC)c2cc(Nc3nn(C4COCCC4C#N)cc3C(N)=O)ccc2OB1O |
| InChI | InChI=1S/C22H26BN5O4/c1-3-15-16-9-14(5-6-20(16)32-23(30)18(15)4-2)26-22-17(21(25)29)11-28(27-22)19-12-31-8-7-13(19)10-24/h5-6,9,11,13,19,30H,3-4,7-8,12H2,1-2H3,(H2,25,29)(H,26,27) |
| InChIKey | RTQHYYLTXZRWNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|