C21H24BN5O3 — CID 164542810
1-[(2S)-2-cyanocyclopentyl]-3-[(2-hydroxy-4-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 164542810) has the molecular formula C21H24BN5O3 and a molecular weight of 405.27 g/mol. Its IUPAC name is 1-[(2S)-2-cyanocyclopentyl]-3-[(2-hydroxy-4-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(2S)-2-cyanocyclopentyl]-3-[(2-hydroxy-4-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164542810 |
| Molecular Formula | C21H24BN5O3 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[(2S)-2-cyanocyclopentyl]-3-[(2-hydroxy-4-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | CC(C)C1=CB(O)Oc2ccc(Nc3nn(C4CCC[C@@H]4C#N)cc3C(N)=O)cc21 |
| InChI | InChI=1S/C21H24BN5O3/c1-12(2)16-9-22(29)30-19-7-6-14(8-15(16)19)25-21-17(20(24)28)11-27(26-21)18-5-3-4-13(18)10-23/h6-9,11-13,18,29H,3-5H2,1-2H3,(H2,24,28)(H,25,26)/t13-,18?/m1/s1 |
| InChIKey | SYDDTWYEOFRTNK-YJJYDOSJSA-N |
| XLogP | 3.04 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|