C17H18BN5O3 — CID 175521148
1-[(1R,2R)-2-cyanocyclopentyl]-3-[(2-hydroxy-3H-1,2-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 175521148) has the molecular formula C17H18BN5O3 and a molecular weight of 351.18 g/mol. Its IUPAC name is 1-[(1R,2R)-2-cyanocyclopentyl]-3-[(2-hydroxy-3H-1,2-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1R,2R)-2-cyanocyclopentyl]-3-[(2-hydroxy-3H-1,2-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175521148 |
| Molecular Formula | C17H18BN5O3 |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-[(1R,2R)-2-cyanocyclopentyl]-3-[(2-hydroxy-3H-1,2-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | N#C[C@@H]1CCC[C@H]1n1cc(C(N)=O)c(Nc2ccc3c(c2)OB(O)C3)n1 |
| InChI | InChI=1S/C17H18BN5O3/c19-8-11-2-1-3-14(11)23-9-13(16(20)24)17(22-23)21-12-5-4-10-7-18(25)26-15(10)6-12/h4-6,9,11,14,25H,1-3,7H2,(H2,20,24)(H,21,22)/t11-,14+/m0/s1 |
| InChIKey | VNZOOHWCAWDFHF-SMDDNHRTSA-N |
| XLogP | 1.54 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|