C19H19BFN5O3 — CID 164800519
1-(2-cyanocyclopentyl)-3-[(8-fluoro-2-hydroxy-3-methyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 164800519) has the molecular formula C19H19BFN5O3 and a molecular weight of 395.20 g/mol. Its IUPAC name is 1-(2-cyanocyclopentyl)-3-[(8-fluoro-2-hydroxy-3-methyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanocyclopentyl)-3-[(8-fluoro-2-hydroxy-3-methyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164800519 |
| Molecular Formula | C19H19BFN5O3 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-(2-cyanocyclopentyl)-3-[(8-fluoro-2-hydroxy-3-methyl-1,2-benzoxaborinin-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | CC1=Cc2cc(Nc3nn(C4CCCC4C#N)cc3C(N)=O)cc(F)c2OB1O |
| InChI | InChI=1S/C19H19BFN5O3/c1-10-5-12-6-13(7-15(21)17(12)29-20(10)28)24-19-14(18(23)27)9-26(25-19)16-4-2-3-11(16)8-22/h5-7,9,11,16,28H,2-4H2,1H3,(H2,23,27)(H,24,25) |
| InChIKey | RNLDTJWZYUHMMQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|