C17H17BFN5O4 — CID 174012991
1-[(3R,4S)-4-cyanooxan-3-yl]-3-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 174012991) has the molecular formula C17H17BFN5O4 and a molecular weight of 385.16 g/mol. Its IUPAC name is 1-[(3R,4S)-4-cyanooxan-3-yl]-3-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3R,4S)-4-cyanooxan-3-yl]-3-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174012991 |
| Molecular Formula | C17H17BFN5O4 |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[(3R,4S)-4-cyanooxan-3-yl]-3-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | N#C[C@H]1CCOC[C@@H]1n1cc(C(N)=O)c(Nc2cc(F)c3c(c2)B(O)OC3)n1 |
| InChI | InChI=1S/C17H17BFN5O4/c19-14-4-10(3-13-12(14)7-28-18(13)26)22-17-11(16(21)25)6-24(23-17)15-8-27-2-1-9(15)5-20/h3-4,6,9,15,26H,1-2,7-8H2,(H2,21,25)(H,22,23)/t9-,15+/m1/s1 |
| InChIKey | DVEBEGSPYSFWRG-PSLIRLAXSA-N |
| XLogP | 0.18 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|