C20H22BN5O5 — CID 164542770
1-[(4S)-4-cyanooxan-3-yl]-3-[[2-hydroxy-3-(2-hydroxyethyl)-1,2-benzoxaborinin-6-yl]amino]pyrazole-4-carboxamide (PubChem CID 164542770) has the molecular formula C20H22BN5O5 and a molecular weight of 423.24 g/mol. Its IUPAC name is 1-[(4S)-4-cyanooxan-3-yl]-3-[[2-hydroxy-3-(2-hydroxyethyl)-1,2-benzoxaborinin-6-yl]amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(4S)-4-cyanooxan-3-yl]-3-[[2-hydroxy-3-(2-hydroxyethyl)-1,2-benzoxaborinin-6-yl]amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164542770 |
| Molecular Formula | C20H22BN5O5 |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[(4S)-4-cyanooxan-3-yl]-3-[[2-hydroxy-3-(2-hydroxyethyl)-1,2-benzoxaborinin-6-yl]amino]pyrazole-4-carboxamide |
| SMILES | N#C[C@H]1CCOCC1n1cc(C(N)=O)c(Nc2ccc3c(c2)C=C(CCO)B(O)O3)n1 |
| InChI | InChI=1S/C20H22BN5O5/c22-9-12-4-6-30-11-17(12)26-10-16(19(23)28)20(25-26)24-15-1-2-18-13(8-15)7-14(3-5-27)21(29)31-18/h1-2,7-8,10,12,17,27,29H,3-6,11H2,(H2,23,28)(H,24,25)/t12-,17?/m1/s1 |
| InChIKey | VIHMUXMZQRLOHJ-MTATWXBHSA-N |
| XLogP | 1.00 |
| TPSA | 155.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|