C18H20BN5O4 — CID 174013117
1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3-methyl-3H-2,1-benzoxaborol-5-yl)amino]pyrazole-4-carboxamide (PubChem CID 174013117) has the molecular formula C18H20BN5O4 and a molecular weight of 381.20 g/mol. Its IUPAC name is 1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3-methyl-3H-2,1-benzoxaborol-5-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3-methyl-3H-2,1-benzoxaborol-5-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013117 |
| Molecular Formula | C18H20BN5O4 |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3-methyl-3H-2,1-benzoxaborol-5-yl)amino]pyrazole-4-carboxamide |
| SMILES | CC1OB(O)c2ccc(Nc3nn([C@H]4COCCC4C#N)cc3C(N)=O)cc21 |
| InChI | InChI=1S/C18H20BN5O4/c1-10-13-6-12(2-3-15(13)19(26)28-10)22-18-14(17(21)25)8-24(23-18)16-9-27-5-4-11(16)7-20/h2-3,6,8,10-11,16,26H,4-5,9H2,1H3,(H2,21,25)(H,22,23)/t10?,11?,16-/m0/s1 |
| InChIKey | NXCRDGKYFPXJEK-PRDDCLIZSA-N |
| XLogP | 0.61 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|