C17H18BN5O4 — CID 174012995
1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide (PubChem CID 174012995) has the molecular formula C17H18BN5O4 and a molecular weight of 367.17 g/mol. Its IUPAC name is 1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174012995 |
| Molecular Formula | C17H18BN5O4 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[(3R)-4-cyanooxan-3-yl]-3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]pyrazole-4-carboxamide |
| SMILES | N#CC1CCOC[C@@H]1n1cc(C(N)=O)c(Nc2ccc3c(c2)B(O)OC3)n1 |
| InChI | InChI=1S/C17H18BN5O4/c19-6-10-3-4-26-9-15(10)23-7-13(16(20)24)17(22-23)21-12-2-1-11-8-27-18(25)14(11)5-12/h1-2,5,7,10,15,25H,3-4,8-9H2,(H2,20,24)(H,21,22)/t10?,15-/m0/s1 |
| InChIKey | ZJKMADCSLOMTIQ-WRXSAAJRSA-N |
| XLogP | 0.04 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|