C18H19N7O — CID 89463355
1-(2-cyanocyclohexyl)-3-[(6-cyano-5-methyl-3-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 89463355) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 1-(2-cyanocyclohexyl)-3-[(6-cyano-5-methyl-3-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanocyclohexyl)-3-[(6-cyano-5-methyl-3-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89463355 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-(2-cyanocyclohexyl)-3-[(6-cyano-5-methyl-3-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | Cc1cc(Nc2nn(C3CCCCC3C#N)cc2C(N)=O)cnc1C#N |
| InChI | InChI=1S/C18H19N7O/c1-11-6-13(9-22-15(11)8-20)23-18-14(17(21)26)10-25(24-18)16-5-3-2-4-12(16)7-19/h6,9-10,12,16H,2-5H2,1H3,(H2,21,26)(H,23,24) |
| InChIKey | JLXIQWBEEXOOKJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |