C22H23N7O3S — CID 89464013
1-(2-cyanocyclohexyl)-3-[4-(pyridin-4-ylsulfamoyl)anilino]pyrazole-4-carboxamide (PubChem CID 89464013) has the molecular formula C22H23N7O3S and a molecular weight of 465.54 g/mol. Its IUPAC name is 1-(2-cyanocyclohexyl)-3-[4-(pyridin-4-ylsulfamoyl)anilino]pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanocyclohexyl)-3-[4-(pyridin-4-ylsulfamoyl)anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89464013 |
| Molecular Formula | C22H23N7O3S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 1-(2-cyanocyclohexyl)-3-[4-(pyridin-4-ylsulfamoyl)anilino]pyrazole-4-carboxamide |
| SMILES | N#CC1CCCCC1n1cc(C(N)=O)c(Nc2ccc(S(=O)(=O)Nc3ccncc3)cc2)n1 |
| InChI | InChI=1S/C22H23N7O3S/c23-13-15-3-1-2-4-20(15)29-14-19(21(24)30)22(27-29)26-16-5-7-18(8-6-16)33(31,32)28-17-9-11-25-12-10-17/h5-12,14-15,20H,1-4H2,(H2,24,30)(H,25,28)(H,26,27) |
| InChIKey | QYOLTLHSIVAINW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |