C18H21N5O4S — CID 90355487
1-(2-cyano-4-hydroxycyclohexyl)-3-(4-methylsulfonylanilino)pyrazole-4-carboxamide (PubChem CID 90355487) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-(2-cyano-4-hydroxycyclohexyl)-3-(4-methylsulfonylanilino)pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyano-4-hydroxycyclohexyl)-3-(4-methylsulfonylanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90355487 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-(2-cyano-4-hydroxycyclohexyl)-3-(4-methylsulfonylanilino)pyrazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2nn(C3CCC(O)CC3C#N)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H21N5O4S/c1-28(26,27)14-5-2-12(3-6-14)21-18-15(17(20)25)10-23(22-18)16-7-4-13(24)8-11(16)9-19/h2-3,5-6,10-11,13,16,24H,4,7-8H2,1H3,(H2,20,25)(H,21,22) |
| InChIKey | HFIMQKPETJSAHQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |