C18H20FN5O — CID 130286232
1-[(1S)-2-cyano-4-methylcyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 130286232) has the molecular formula C18H20FN5O and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[(1S)-2-cyano-4-methylcyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[(1S)-2-cyano-4-methylcyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 130286232 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(1S)-2-cyano-4-methylcyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | CC1CC[C@H](n2cc(C(N)=O)c(Nc3ccc(F)cc3)n2)C(C#N)C1 |
| InChI | InChI=1S/C18H20FN5O/c1-11-2-7-16(12(8-11)9-20)24-10-15(17(21)25)18(23-24)22-14-5-3-13(19)4-6-14/h3-6,10-12,16H,2,7-8H2,1H3,(H2,21,25)(H,22,23)/t11?,12?,16-/m0/s1 |
| InChIKey | GENHOJVVUAFGEC-PPUFBPAQSA-N |
| XLogP | 3.37 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |