C15H14FN5OS — CID 90350624
1-[(3S)-4-cyanothiolan-3-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 90350624) has the molecular formula C15H14FN5OS and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[(3S)-4-cyanothiolan-3-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[(3S)-4-cyanothiolan-3-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90350624 |
| Molecular Formula | C15H14FN5OS |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-[(3S)-4-cyanothiolan-3-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | N#CC1CSC[C@H]1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H14FN5OS/c16-10-1-3-11(4-2-10)19-15-12(14(18)22)6-21(20-15)13-8-23-7-9(13)5-17/h1-4,6,9,13H,7-8H2,(H2,18,22)(H,19,20)/t9?,13-/m1/s1 |
| InChIKey | DEDPFQMAKKSQDJ-WCRCJTMVSA-N |
| XLogP | 2.29 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |