C17H19FN6O — CID 90367381
1-[(2S,4S)-4-amino-2-cyanocyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 90367381) has the molecular formula C17H19FN6O and a molecular weight of 342.38 g/mol. Its IUPAC name is 1-[(2S,4S)-4-amino-2-cyanocyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[(2S,4S)-4-amino-2-cyanocyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90367381 |
| Molecular Formula | C17H19FN6O |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[(2S,4S)-4-amino-2-cyanocyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | N#C[C@H]1C[C@@H](N)CCC1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H19FN6O/c18-11-1-4-13(5-2-11)22-17-14(16(21)25)9-24(23-17)15-6-3-12(20)7-10(15)8-19/h1-2,4-5,9-10,12,15H,3,6-7,20H2,(H2,21,25)(H,22,23)/t10-,12+,15?/m1/s1 |
| InChIKey | CVGYTGPFEWIONX-QEQOOXKLSA-N |
| XLogP | 2.06 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |