C24H30BN5O5 — CID 164800619
methyl 5-[[4-carbamoyl-1-[(2S)-2-cyanocyclopentyl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 164800619) has the molecular formula C24H30BN5O5 and a molecular weight of 479.35 g/mol. Its IUPAC name is methyl 5-[[4-carbamoyl-1-[(2S)-2-cyanocyclopentyl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 5-[[4-carbamoyl-1-[(2S)-2-cyanocyclopentyl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 164800619 |
| Molecular Formula | C24H30BN5O5 |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | methyl 5-[[4-carbamoyl-1-[(2S)-2-cyanocyclopentyl]pyrazol-3-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(Nc2nn(C3CCC[C@@H]3C#N)cc2C(N)=O)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H30BN5O5/c1-23(2)24(3,4)35-25(34-23)18-10-9-15(11-16(18)22(32)33-5)28-21-17(20(27)31)13-30(29-21)19-8-6-7-14(19)12-26/h9-11,13-14,19H,6-8H2,1-5H3,(H2,27,31)(H,28,29)/t14-,19?/m1/s1 |
| InChIKey | IHHDMURQANYXCV-MJTSIZKDSA-N |
| XLogP | 2.68 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|