C22H28BN5O4 — CID 164542994
5-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile (PubChem CID 164542994) has the molecular formula C22H28BN5O4 and a molecular weight of 437.31 g/mol. Its IUPAC name is 5-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile.
| Compound Name | 5-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile |
|---|---|
| PubChem CID | 164542994 |
| Molecular Formula | C22H28BN5O4 |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 5-[(3,4-diethyl-2-hydroxy-1,2-benzoxaborinin-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile |
| SMILES | CCC1=C(CC)c2cc(Nc3[nH]ncc3C(N)=O)ccc2OB1O.N#CC1CCOCC1 |
| InChI | InChI=1S/C16H19BN4O3.C6H9NO/c1-3-10-11-7-9(20-16-12(15(18)22)8-19-21-16)5-6-14(11)24-17(23)13(10)4-2;7-5-6-1-3-8-4-2-6/h5-8,23H,3-4H2,1-2H3,(H2,18,22)(H2,19,20,21);6H,1-4H2 |
| InChIKey | PIJWEBBXWMQNQU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|