C17H16N6O2 — CID 123285570
5-(4-cyanoanilino)-N-(4-cyanooxan-3-yl)-1H-pyrazole-4-carboxamide (PubChem CID 123285570) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 5-(4-cyanoanilino)-N-(4-cyanooxan-3-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-cyanoanilino)-N-(4-cyanooxan-3-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123285570 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 5-(4-cyanoanilino)-N-(4-cyanooxan-3-yl)-1H-pyrazole-4-carboxamide |
| SMILES | N#Cc1ccc(Nc2[nH]ncc2C(=O)NC2COCCC2C#N)cc1 |
| InChI | InChI=1S/C17H16N6O2/c18-7-11-1-3-13(4-2-11)21-16-14(9-20-23-16)17(24)22-15-10-25-6-5-12(15)8-19/h1-4,9,12,15H,5-6,10H2,(H,22,24)(H2,20,21,23) |
| InChIKey | XIHMFWSVHBOXNL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |